C32H46N4O5 — CID 18054423
tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054423) has the molecular formula C32H46N4O5 and a molecular weight of 566.74 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054423 |
| Molecular Formula | C32H46N4O5 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1c(C)cccc1C)c1ccccc1 |
| InChI | InChI=1S/C32H46N4O5/c1-7-8-9-10-14-20-36(30(39)25(21-26(33)37)34-31(40)41-32(4,5)6)28(24-18-12-11-13-19-24)29(38)35-27-22(2)16-15-17-23(27)3/h11-13,15-19,25,28H,7-10,14,20-21H2,1-6H3,(H2,33,37)(H,34,40)(H,35,38) |
| InChIKey | WQXTZOKEUDBBCB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|