C31H44N4O6 — CID 18054424
tert-butyl N-[4-amino-1-[heptyl-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054424) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[heptyl-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[heptyl-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054424 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | tert-butyl N-[4-amino-1-[heptyl-[2-(4-methoxyanilino)-2-oxo-1-phenylethyl]amino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H44N4O6/c1-6-7-8-9-13-20-35(29(38)25(21-26(32)36)34-30(39)41-31(2,3)4)27(22-14-11-10-12-15-22)28(37)33-23-16-18-24(40-5)19-17-23/h10-12,14-19,25,27H,6-9,13,20-21H2,1-5H3,(H2,32,36)(H,33,37)(H,34,39) |
| InChIKey | MBYHSXPZPOMNQU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|