C31H40N4O6 — CID 18053389
tert-butyl N-[4-amino-1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18053389) has the molecular formula C31H40N4O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18053389 |
| Molecular Formula | C31H40N4O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccc(OC)cc2)N(CCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H40N4O6/c1-7-9-10-19-35(29(38)25(20-26(32)36)34-30(39)41-31(3,4)5)27(22-13-11-21(8-2)12-14-22)28(37)33-23-15-17-24(40-6)18-16-23/h2,11-18,25,27H,7,9-10,19-20H2,1,3-6H3,(H2,32,36)(H,33,37)(H,34,39) |
| InChIKey | RSRIQRKIOMVOMG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|