C36H43N3O6 — CID 18210881
tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18210881) has the molecular formula C36H43N3O6 and a molecular weight of 613.76 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18210881 |
| Molecular Formula | C36H43N3O6 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-pentylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccc(OC)cc2)N(CCCCC)C(=O)C(Cc2ccc(O)cc2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C36H43N3O6/c1-7-9-10-23-39(34(42)31(38-35(43)45-36(3,4)5)24-26-13-19-29(40)20-14-26)32(27-15-11-25(8-2)12-16-27)33(41)37-28-17-21-30(44-6)22-18-28/h2,11-22,31-32,40H,7,9-10,23-24H2,1,3-6H3,(H,37,41)(H,38,43) |
| InChIKey | CRQQOHURJLFWGT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|