C32H47N3O6 — CID 18048244
tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18048244) has the molecular formula C32H47N3O6 and a molecular weight of 569.74 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18048244 |
| Molecular Formula | C32H47N3O6 |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.35 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C32H47N3O6/c1-8-9-10-11-20-35(30(38)27(21-22(2)3)34-31(39)41-32(4,5)6)28(23-12-16-25(36)17-13-23)29(37)33-24-14-18-26(40-7)19-15-24/h12-19,22,27-28,36H,8-11,20-21H2,1-7H3,(H,33,37)(H,34,39) |
| InChIKey | GLVQWGKNAXGSOO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|