C34H51N3O6 — CID 18048904
tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18048904) has the molecular formula C34H51N3O6 and a molecular weight of 597.80 g/mol. Its IUPAC name is tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18048904 |
| Molecular Formula | C34H51N3O6 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.38 |
| IUPAC Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1cccc(C)c1O |
| InChI | InChI=1S/C34H51N3O6/c1-9-10-11-12-13-21-37(32(40)28(22-23(2)3)36-33(41)43-34(5,6)7)29(27-16-14-15-24(4)30(27)38)31(39)35-25-17-19-26(42-8)20-18-25/h14-20,23,28-29,38H,9-13,21-22H2,1-8H3,(H,35,39)(H,36,41) |
| InChIKey | WDMYALVUNKDIGC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|