C34H51N3O5 — CID 18048754
tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18048754) has the molecular formula C34H51N3O5 and a molecular weight of 581.80 g/mol. Its IUPAC name is tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18048754 |
| Molecular Formula | C34H51N3O5 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.38 |
| IUPAC Name | tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(2-methylphenyl)-2-oxoethyl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccccc1C |
| InChI | InChI=1S/C34H51N3O5/c1-9-10-11-12-15-22-37(32(39)29(23-24(2)3)36-33(40)42-34(5,6)7)30(28-17-14-13-16-25(28)4)31(38)35-26-18-20-27(41-8)21-19-26/h13-14,16-21,24,29-30H,9-12,15,22-23H2,1-8H3,(H,35,38)(H,36,40) |
| InChIKey | TZJZDLXYLXUPHV-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|