C30H51N3O5 — CID 18048324
tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-hexylamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18048324) has the molecular formula C30H51N3O5 and a molecular weight of 533.75 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-hexylamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-hexylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18048324 |
| Molecular Formula | C30H51N3O5 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(2-hydroxy-3-methylphenyl)-2-oxoethyl]-hexylamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)c1cccc(C)c1O |
| InChI | InChI=1S/C30H51N3O5/c1-11-12-13-14-18-33(27(36)23(19-20(2)3)31-28(37)38-30(8,9)10)24(26(35)32-29(5,6)7)22-17-15-16-21(4)25(22)34/h15-17,20,23-24,34H,11-14,18-19H2,1-10H3,(H,31,37)(H,32,35) |
| InChIKey | HECKPBUVWZZQOB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|