C30H49N3O7 — CID 18047766
ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-pentylamino]acetyl]amino]propanoate (PubChem CID 18047766) has the molecular formula C30H49N3O7 and a molecular weight of 563.74 g/mol. Its IUPAC name is ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-pentylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-pentylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18047766 |
| Molecular Formula | C30H49N3O7 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | ethyl 3-[[2-(2-hydroxy-3-methylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-pentylamino]acetyl]amino]propanoate |
| SMILES | CCCCCN(C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)C(C(=O)NCCC(=O)OCC)c1cccc(C)c1O |
| InChI | InChI=1S/C30H49N3O7/c1-9-11-12-18-33(28(37)23(19-20(3)4)32-29(38)40-30(6,7)8)25(22-15-13-14-21(5)26(22)35)27(36)31-17-16-24(34)39-10-2/h13-15,20,23,25,35H,9-12,16-19H2,1-8H3,(H,31,36)(H,32,38) |
| InChIKey | ZNPRAXKWMBYDNW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|