C27H45N3O6 — CID 18037493
tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18037493) has the molecular formula C27H45N3O6 and a molecular weight of 507.67 g/mol. Its IUPAC name is tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18037493 |
| Molecular Formula | C27H45N3O6 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | tert-butyl N-[1-[heptyl-[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(propan-2-ylamino)ethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C(=O)NC(C)C)c1cccc(C)c1O |
| InChI | InChI=1S/C27H45N3O6/c1-8-9-10-11-12-16-30(25(34)21(17-31)29-26(35)36-27(5,6)7)22(24(33)28-18(2)3)20-15-13-14-19(4)23(20)32/h13-15,18,21-22,31-32H,8-12,16-17H2,1-7H3,(H,28,33)(H,29,35) |
| InChIKey | XLNSSLOECVORIJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|