C31H41N3O5 — CID 18020329
tert-butyl N-[2-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate (PubChem CID 18020329) has the molecular formula C31H41N3O5 and a molecular weight of 535.69 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020329 |
| Molecular Formula | C31H41N3O5 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | tert-butyl N-[2-[[1-(4-ethynylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccc(OC)cc2)N(CCCCCCC)C(=O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H41N3O5/c1-7-9-10-11-12-21-34(27(35)22-32-30(37)39-31(3,4)5)28(24-15-13-23(8-2)14-16-24)29(36)33-25-17-19-26(38-6)20-18-25/h2,13-20,28H,7,9-12,21-22H2,1,3-6H3,(H,32,37)(H,33,36) |
| InChIKey | PILRTACGWCYDRH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|