C24H35N3O4 — CID 18017184
tert-butyl N-[2-[[2-(tert-butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-propylamino]-2-oxoethyl]carbamate (PubChem CID 18017184) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(tert-butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-propylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(tert-butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-propylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18017184 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | tert-butyl N-[2-[[2-(tert-butylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-propylamino]-2-oxoethyl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NC(C)(C)C)N(CCC)C(=O)CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H35N3O4/c1-9-15-27(19(28)16-25-22(30)31-24(6,7)8)20(21(29)26-23(3,4)5)18-13-11-17(10-2)12-14-18/h2,11-14,20H,9,15-16H2,1,3-8H3,(H,25,30)(H,26,29) |
| InChIKey | FICDBBJCYIQJMM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|