C31H45N3O5 — CID 18020479
tert-butyl N-[2-[[1-(2,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate (PubChem CID 18020479) has the molecular formula C31H45N3O5 and a molecular weight of 539.72 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(2,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(2,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 18020479 |
| Molecular Formula | C31H45N3O5 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | tert-butyl N-[2-[[1-(2,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCCCCN(C(=O)CNC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C31H45N3O5/c1-8-9-10-11-12-19-34(27(35)21-32-30(37)39-31(4,5)6)28(26-20-22(2)13-14-23(26)3)29(36)33-24-15-17-25(38-7)18-16-24/h13-18,20,28H,8-12,19,21H2,1-7H3,(H,32,37)(H,33,36) |
| InChIKey | DNRXYSRCRBPZOD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|