C27H38N4O7 — CID 18053392
methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-pentylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate (PubChem CID 18053392) has the molecular formula C27H38N4O7 and a molecular weight of 530.62 g/mol. Its IUPAC name is methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-pentylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-pentylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18053392 |
| Molecular Formula | C27H38N4O7 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-pentylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate |
| SMILES | C#Cc1ccc(C(C(=O)NCC(=O)OC)N(CCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H38N4O7/c1-7-9-10-15-31(25(35)20(16-21(28)32)30-26(36)38-27(3,4)5)23(24(34)29-17-22(33)37-6)19-13-11-18(8-2)12-14-19/h2,11-14,20,23H,7,9-10,15-17H2,1,3-6H3,(H2,28,32)(H,29,34)(H,30,36) |
| InChIKey | HIYICKBPCVDKNS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|