C28H41N3O6S — CID 18060232
methyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate (PubChem CID 18060232) has the molecular formula C28H41N3O6S and a molecular weight of 547.72 g/mol. Its IUPAC name is methyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18060232 |
| Molecular Formula | C28H41N3O6S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | methyl 2-[[2-(4-ethynylphenyl)-2-[heptyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]acetate |
| SMILES | C#Cc1ccc(C(C(=O)NCC(=O)OC)N(CCCCCCC)C(=O)C(CS)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H41N3O6S/c1-7-9-10-11-12-17-31(26(34)22(19-38)30-27(35)37-28(3,4)5)24(25(33)29-18-23(32)36-6)21-15-13-20(8-2)14-16-21/h2,13-16,22,24,38H,7,9-12,17-19H2,1,3-6H3,(H,29,33)(H,30,35) |
| InChIKey | AWNYBNLRSFHNDR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|