C32H43N3O4S — CID 18060224
tert-butyl N-[1-[[2-(benzylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate (PubChem CID 18060224) has the molecular formula C32H43N3O4S and a molecular weight of 565.78 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(benzylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(benzylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18060224 |
| Molecular Formula | C32H43N3O4S |
| Molecular Weight | 565.78 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | tert-butyl N-[1-[[2-(benzylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-1-oxo-3-sulfanylpropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NCc2ccccc2)N(CCCCCCC)C(=O)C(CS)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H43N3O4S/c1-6-8-9-10-14-21-35(30(37)27(23-40)34-31(38)39-32(3,4)5)28(26-19-17-24(7-2)18-20-26)29(36)33-22-25-15-12-11-13-16-25/h2,11-13,15-20,27-28,40H,6,8-10,14,21-23H2,1,3-5H3,(H,33,36)(H,34,38) |
| InChIKey | AZKIPRWNRSXWPJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.78 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|