C29H43N3O6S — CID 18059661
ethyl 3-[[2-(4-ethynylphenyl)-2-[hexyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]propanoate (PubChem CID 18059661) has the molecular formula C29H43N3O6S and a molecular weight of 561.75 g/mol. Its IUPAC name is ethyl 3-[[2-(4-ethynylphenyl)-2-[hexyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(4-ethynylphenyl)-2-[hexyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18059661 |
| Molecular Formula | C29H43N3O6S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | ethyl 3-[[2-(4-ethynylphenyl)-2-[hexyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-sulfanylpropanoyl]amino]acetyl]amino]propanoate |
| SMILES | C#Cc1ccc(C(C(=O)NCCC(=O)OCC)N(CCCCCC)C(=O)C(CS)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H43N3O6S/c1-7-10-11-12-19-32(27(35)23(20-39)31-28(36)38-29(4,5)6)25(22-15-13-21(8-2)14-16-22)26(34)30-18-17-24(33)37-9-3/h2,13-16,23,25,39H,7,9-12,17-20H2,1,3-6H3,(H,30,34)(H,31,36) |
| InChIKey | OCQAOKISSDWERK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|