C34H53N3O6 — CID 18049116
ethyl 3-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]propanoate (PubChem CID 18049116) has the molecular formula C34H53N3O6 and a molecular weight of 599.81 g/mol. Its IUPAC name is ethyl 3-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18049116 |
| Molecular Formula | C34H53N3O6 |
| Molecular Weight | 599.81 g/mol |
| Exact Mass | 599.39 |
| IUPAC Name | ethyl 3-[[2-(4-ethynylphenyl)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]-octylamino]acetyl]amino]propanoate |
| SMILES | C#Cc1ccc(C(C(=O)NCCC(=O)OCC)N(CCCCCCCC)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H53N3O6/c1-9-12-13-14-15-16-23-37(32(40)28(24-25(4)5)36-33(41)43-34(6,7)8)30(27-19-17-26(10-2)18-20-27)31(39)35-22-21-29(38)42-11-3/h2,17-20,25,28,30H,9,11-16,21-24H2,1,3-8H3,(H,35,39)(H,36,41) |
| InChIKey | POLMWTBQPSEHEE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|