C28H43N3O5 — CID 18045402
tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-hydroxyethyl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18045402) has the molecular formula C28H43N3O5 and a molecular weight of 501.67 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-hydroxyethyl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-hydroxyethyl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18045402 |
| Molecular Formula | C28H43N3O5 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-hydroxyethyl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NCCCCC)N(CCO)C(=O)C(CC(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C28H43N3O5/c1-8-10-11-16-29-25(33)24(22-14-12-21(9-2)13-15-22)31(17-18-32)26(34)23(19-20(3)4)30-27(35)36-28(5,6)7/h2,12-15,20,23-24,32H,8,10-11,16-19H2,1,3-7H3,(H,29,33)(H,30,35) |
| InChIKey | SWXXMKBXBDRYEI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|