C30H47N3O5 — CID 18037137
tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18037137) has the molecular formula C30H47N3O5 and a molecular weight of 529.72 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18037137 |
| Molecular Formula | C30H47N3O5 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.35 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-oxo-2-(pentylamino)ethyl]-(5-methylhexan-2-yl)amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NCCCCC)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C)CCC(C)C)cc1 |
| InChI | InChI=1S/C30H47N3O5/c1-9-11-12-19-31-27(35)26(24-17-15-23(10-2)16-18-24)33(22(5)14-13-21(3)4)28(36)25(20-34)32-29(37)38-30(6,7)8/h2,15-18,21-22,25-26,34H,9,11-14,19-20H2,1,3-8H3,(H,31,35)(H,32,37) |
| InChIKey | ONTFSNDQPNEVPZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|