C34H51N3O4 — CID 18217324
tert-butyl N-[1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217324) has the molecular formula C34H51N3O4 and a molecular weight of 565.80 g/mol. Its IUPAC name is tert-butyl N-[1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217324 |
| Molecular Formula | C34H51N3O4 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.39 |
| IUPAC Name | tert-butyl N-[1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C)CCC(C)C |
| InChI | InChI=1S/C34H51N3O4/c1-8-9-16-23-35-31(38)30(28-19-14-11-15-20-28)37(26(4)22-21-25(2)3)32(39)29(24-27-17-12-10-13-18-27)36-33(40)41-34(5,6)7/h10-15,17-20,25-26,29-30H,8-9,16,21-24H2,1-7H3,(H,35,38)(H,36,40) |
| InChIKey | LLDVZVWRMQXGIC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|