C31H53N3O4 — CID 18025632
tert-butyl N-[3-methyl-1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 18025632) has the molecular formula C31H53N3O4 and a molecular weight of 531.78 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18025632 |
| Molecular Formula | C31H53N3O4 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.40 |
| IUPAC Name | tert-butyl N-[3-methyl-1-[5-methylhexan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)C(C)CCC(C)C |
| InChI | InChI=1S/C31H53N3O4/c1-10-12-16-21-32-28(35)27(25-17-14-13-15-18-25)34(24(6)20-19-22(3)4)29(36)26(23(5)11-2)33-30(37)38-31(7,8)9/h13-15,17-18,22-24,26-27H,10-12,16,19-21H2,1-9H3,(H,32,35)(H,33,37) |
| InChIKey | LUYUZWLIIPWHNV-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|