C25H41N3O5 — CID 18035892
tert-butyl N-[1-[butan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 18035892) has the molecular formula C25H41N3O5 and a molecular weight of 463.62 g/mol. Its IUPAC name is tert-butyl N-[1-[butan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18035892 |
| Molecular Formula | C25H41N3O5 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | tert-butyl N-[1-[butan-2-yl-[2-oxo-2-(pentylamino)-1-phenylethyl]amino]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(C(=O)C(CO)NC(=O)OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C25H41N3O5/c1-7-9-13-16-26-22(30)21(19-14-11-10-12-15-19)28(18(3)8-2)23(31)20(17-29)27-24(32)33-25(4,5)6/h10-12,14-15,18,20-21,29H,7-9,13,16-17H2,1-6H3,(H,26,30)(H,27,32) |
| InChIKey | UVQSKANRCSECPM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|