C29H42N4O7 — CID 18054532
methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-heptylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate (PubChem CID 18054532) has the molecular formula C29H42N4O7 and a molecular weight of 558.68 g/mol. Its IUPAC name is methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-heptylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-heptylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 18054532 |
| Molecular Formula | C29H42N4O7 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | methyl 2-[[2-[[4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoyl]-heptylamino]-2-(4-ethynylphenyl)acetyl]amino]acetate |
| SMILES | C#Cc1ccc(C(C(=O)NCC(=O)OC)N(CCCCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H42N4O7/c1-7-9-10-11-12-17-33(27(37)22(18-23(30)34)32-28(38)40-29(3,4)5)25(26(36)31-19-24(35)39-6)21-15-13-20(8-2)14-16-21/h2,13-16,22,25H,7,9-12,17-19H2,1,3-6H3,(H2,30,34)(H,31,36)(H,32,38) |
| InChIKey | CPGLOXHTSDXQDZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|