C31H46N4O5 — CID 18053953
tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18053953) has the molecular formula C31H46N4O5 and a molecular weight of 554.73 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18053953 |
| Molecular Formula | C31H46N4O5 |
| Molecular Weight | 554.73 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NC2CCCCC2)N(CCCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H46N4O5/c1-6-8-9-13-20-35(29(38)25(21-26(32)36)34-30(39)40-31(3,4)5)27(23-18-16-22(7-2)17-19-23)28(37)33-24-14-11-10-12-15-24/h2,16-19,24-25,27H,6,8-15,20-21H2,1,3-5H3,(H2,32,36)(H,33,37)(H,34,39) |
| InChIKey | VSIMSUSWLSYVQJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.73 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|