C34H53N3O4 — CID 18026023
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18026023) has the molecular formula C34H53N3O4 and a molecular weight of 567.82 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18026023 |
| Molecular Formula | C34H53N3O4 |
| Molecular Weight | 567.82 g/mol |
| Exact Mass | 567.40 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-heptylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NC2CCCCC2)N(CCCCCCC)C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)cc1 |
| InChI | InChI=1S/C34H53N3O4/c1-8-11-12-13-17-24-37(32(39)29(25(4)9-2)36-33(40)41-34(5,6)7)30(27-22-20-26(10-3)21-23-27)31(38)35-28-18-15-14-16-19-28/h3,20-23,25,28-30H,8-9,11-19,24H2,1-2,4-7H3,(H,35,38)(H,36,40) |
| InChIKey | ICUKGYNHADMYEY-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.82 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|