C30H49N3O4 — CID 18014098
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014098) has the molecular formula C30H49N3O4 and a molecular weight of 515.74 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014098 |
| Molecular Formula | C30H49N3O4 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.37 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C30H49N3O4/c1-7-9-10-14-21-33(28(35)22(3)31-29(36)37-30(4,5)6)26(24-19-17-23(8-2)18-20-24)27(34)32-25-15-12-11-13-16-25/h17-20,22,25-26H,7-16,21H2,1-6H3,(H,31,36)(H,32,34) |
| InChIKey | MZQCEWAGVXSCOO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|