C29H47N3O5 — CID 18014593
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014593) has the molecular formula C29H47N3O5 and a molecular weight of 517.71 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014593 |
| Molecular Formula | C29H47N3O5 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.35 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1cccc(O)c1 |
| InChI | InChI=1S/C29H47N3O5/c1-6-7-8-9-13-19-32(27(35)21(2)30-28(36)37-29(3,4)5)25(22-15-14-18-24(33)20-22)26(34)31-23-16-11-10-12-17-23/h14-15,18,20-21,23,25,33H,6-13,16-17,19H2,1-5H3,(H,30,36)(H,31,34) |
| InChIKey | KSUYPSWPMIZQEM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|