C29H46N4O6 — CID 18053923
tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18053923) has the molecular formula C29H46N4O6 and a molecular weight of 546.71 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18053923 |
| Molecular Formula | C29H46N4O6 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-hydroxyphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1cccc(O)c1 |
| InChI | InChI=1S/C29H46N4O6/c1-5-6-7-11-17-33(27(37)23(19-24(30)35)32-28(38)39-29(2,3)4)25(20-13-12-16-22(34)18-20)26(36)31-21-14-9-8-10-15-21/h12-13,16,18,21,23,25,34H,5-11,14-15,17,19H2,1-4H3,(H2,30,35)(H,31,36)(H,32,38) |
| InChIKey | UZTMYBIPLMUPOU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|