C32H52N4O5 — CID 18054748
tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054748) has the molecular formula C32H52N4O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054748 |
| Molecular Formula | C32H52N4O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(cyclohexylamino)-1-(3-methylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1cccc(C)c1 |
| InChI | InChI=1S/C32H52N4O5/c1-6-7-8-9-10-14-20-36(30(39)26(22-27(33)37)35-31(40)41-32(3,4)5)28(24-17-15-16-23(2)21-24)29(38)34-25-18-12-11-13-19-25/h15-17,21,25-26,28H,6-14,18-20,22H2,1-5H3,(H2,33,37)(H,34,38)(H,35,40) |
| InChIKey | KGAVHHYBZMKRLO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|