C31H51N3O4 — CID 18014713
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014713) has the molecular formula C31H51N3O4 and a molecular weight of 529.77 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014713 |
| Molecular Formula | C31H51N3O4 |
| Molecular Weight | 529.77 g/mol |
| Exact Mass | 529.39 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(2,4-dimethylphenyl)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NC1CCCCC1)c1ccc(C)cc1C |
| InChI | InChI=1S/C31H51N3O4/c1-8-9-10-11-15-20-34(29(36)24(4)32-30(37)38-31(5,6)7)27(26-19-18-22(2)21-23(26)3)28(35)33-25-16-13-12-14-17-25/h18-19,21,24-25,27H,8-17,20H2,1-7H3,(H,32,37)(H,33,35) |
| InChIKey | NBCAFMAHBZJUAQ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.77 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|