C30H51N3O4 — CID 18014712
tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-heptylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014712) has the molecular formula C30H51N3O4 and a molecular weight of 517.76 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-heptylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014712 |
| Molecular Formula | C30H51N3O4 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.39 |
| IUPAC Name | tert-butyl N-[1-[[1-(2,4-dimethylphenyl)-2-oxo-2-(pentylamino)ethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NCCCCC)c1ccc(C)cc1C |
| InChI | InChI=1S/C30H51N3O4/c1-9-11-13-14-16-20-33(28(35)24(5)32-29(36)37-30(6,7)8)26(27(34)31-19-15-12-10-2)25-18-17-22(3)21-23(25)4/h17-18,21,24,26H,9-16,19-20H2,1-8H3,(H,31,34)(H,32,36) |
| InChIKey | WNQBKVURJCNUAV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|