C28H47N3O4 — CID 18014094
tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014094) has the molecular formula C28H47N3O4 and a molecular weight of 489.70 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014094 |
| Molecular Formula | C28H47N3O4 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.36 |
| IUPAC Name | tert-butyl N-[1-[[2-(tert-butylamino)-1-(4-ethylphenyl)-2-oxoethyl]-hexylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)NC(C)(C)C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C28H47N3O4/c1-10-12-13-14-19-31(25(33)20(3)29-26(34)35-28(7,8)9)23(24(32)30-27(4,5)6)22-17-15-21(11-2)16-18-22/h15-18,20,23H,10-14,19H2,1-9H3,(H,29,34)(H,30,32) |
| InChIKey | APQKOLLENXUJNJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|