C32H49N3O4S — CID 18031153
tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18031153) has the molecular formula C32H49N3O4S and a molecular weight of 571.83 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18031153 |
| Molecular Formula | C32H49N3O4S |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | tert-butyl N-[1-[[2-(cyclohexylamino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)NC2CCCCC2)N(CCCCCC)C(=O)C(CCSC)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C32H49N3O4S/c1-7-9-10-14-22-35(30(37)27(21-23-40-6)34-31(38)39-32(3,4)5)28(25-19-17-24(8-2)18-20-25)29(36)33-26-15-12-11-13-16-26/h2,17-20,26-28H,7,9-16,21-23H2,1,3-6H3,(H,33,36)(H,34,38) |
| InChIKey | PDIITRHPXSGBIX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|