C34H47N3O4S — CID 18031158
tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 18031158) has the molecular formula C34H47N3O4S and a molecular weight of 593.83 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18031158 |
| Molecular Formula | C34H47N3O4S |
| Molecular Weight | 593.83 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | tert-butyl N-[1-[[2-(2,6-dimethylanilino)-1-(4-ethynylphenyl)-2-oxoethyl]-hexylamino]-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2c(C)cccc2C)N(CCCCCC)C(=O)C(CCSC)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H47N3O4S/c1-9-11-12-13-22-37(32(39)28(21-23-42-8)35-33(40)41-34(5,6)7)30(27-19-17-26(10-2)18-20-27)31(38)36-29-24(3)15-14-16-25(29)4/h2,14-20,28,30H,9,11-13,21-23H2,1,3-8H3,(H,35,40)(H,36,38) |
| InChIKey | LUNYYKZDPOEWBN-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.83 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|