C27H39N3O7 — CID 18036862
methyl 2-[[2-(4-ethynylphenyl)-2-[hexyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetate (PubChem CID 18036862) has the molecular formula C27H39N3O7 and a molecular weight of 517.62 g/mol. Its IUPAC name is methyl 2-[[2-(4-ethynylphenyl)-2-[hexyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-(4-ethynylphenyl)-2-[hexyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 18036862 |
| Molecular Formula | C27H39N3O7 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | methyl 2-[[2-(4-ethynylphenyl)-2-[hexyl-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetyl]amino]acetate |
| SMILES | C#Cc1ccc(C(C(=O)NCC(=O)OC)N(CCCCCC)C(=O)C(CO)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H39N3O7/c1-7-9-10-11-16-30(25(34)21(18-31)29-26(35)37-27(3,4)5)23(24(33)28-17-22(32)36-6)20-14-12-19(8-2)13-15-20/h2,12-15,21,23,31H,7,9-11,16-18H2,1,3-6H3,(H,28,33)(H,29,35) |
| InChIKey | QZXICLRFEXDCST-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|