C32H44N4O6 — CID 18053989
tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18053989) has the molecular formula C32H44N4O6 and a molecular weight of 580.73 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18053989 |
| Molecular Formula | C32H44N4O6 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)Nc2ccc(OC)cc2)N(CCCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C32H44N4O6/c1-7-9-10-11-19-36(30(39)26(21-27(33)37)35-31(40)42-32(3,4)5)28(23-14-12-13-22(8-2)20-23)29(38)34-24-15-17-25(41-6)18-16-24/h8,12-18,20,26,28H,2,7,9-11,19,21H2,1,3-6H3,(H2,33,37)(H,34,38)(H,35,40) |
| InChIKey | RFGBZSZNDALBRE-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|