C34H48N4O5 — CID 18054839
tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054839) has the molecular formula C34H48N4O5 and a molecular weight of 592.78 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054839 |
| Molecular Formula | C34H48N4O5 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(3-ethenylphenyl)-2-oxoethyl]-octylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NCc2ccccc2)N(CCCCCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C34H48N4O5/c1-6-8-9-10-11-15-21-38(32(41)28(23-29(35)39)37-33(42)43-34(3,4)5)30(27-20-16-19-25(7-2)22-27)31(40)36-24-26-17-13-12-14-18-26/h7,12-14,16-20,22,28,30H,2,6,8-11,15,21,23-24H2,1,3-5H3,(H2,35,39)(H,36,40)(H,37,42) |
| InChIKey | WYCHLFPSDPKWGF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|