C34H42N4O5 — CID 18053416
tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18053416) has the molecular formula C34H42N4O5 and a molecular weight of 586.73 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18053416 |
| Molecular Formula | C34H42N4O5 |
| Molecular Weight | 586.73 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[1-(3-ethenylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-pentylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)Nc2ccc3ccccc3c2)N(CCCCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C34H42N4O5/c1-6-8-11-19-38(32(41)28(22-29(35)39)37-33(42)43-34(3,4)5)30(26-16-12-13-23(7-2)20-26)31(40)36-27-18-17-24-14-9-10-15-25(24)21-27/h7,9-10,12-18,20-21,28,30H,2,6,8,11,19,22H2,1,3-5H3,(H2,35,39)(H,36,40)(H,37,42) |
| InChIKey | RYICRUBAEDPBQS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.73 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|