C32H46N4O5 — CID 18054059
tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054059) has the molecular formula C32H46N4O5 and a molecular weight of 566.74 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054059 |
| Molecular Formula | C32H46N4O5 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,3-dimethylphenyl)-2-oxoethyl]-hexylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1cccc(C)c1C |
| InChI | InChI=1S/C32H46N4O5/c1-7-8-9-13-19-36(30(39)26(20-27(33)37)35-31(40)41-32(4,5)6)28(25-18-14-15-22(2)23(25)3)29(38)34-21-24-16-11-10-12-17-24/h10-12,14-18,26,28H,7-9,13,19-21H2,1-6H3,(H2,33,37)(H,34,38)(H,35,40) |
| InChIKey | UPLXBYGJXAWJMP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|