C33H48N4O5 — CID 18054674
tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 18054674) has the molecular formula C33H48N4O5 and a molecular weight of 580.77 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18054674 |
| Molecular Formula | C33H48N4O5 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | tert-butyl N-[4-amino-1-[[2-(benzylamino)-1-(2,5-dimethylphenyl)-2-oxoethyl]-heptylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C)C(C(=O)NCc1ccccc1)c1cc(C)ccc1C |
| InChI | InChI=1S/C33H48N4O5/c1-7-8-9-10-14-19-37(31(40)27(21-28(34)38)36-32(41)42-33(4,5)6)29(26-20-23(2)17-18-24(26)3)30(39)35-22-25-15-12-11-13-16-25/h11-13,15-18,20,27,29H,7-10,14,19,21-22H2,1-6H3,(H2,34,38)(H,35,39)(H,36,41) |
| InChIKey | UARYLDVUJJJNBX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|