C34H49N3O5 — CID 18043159
tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18043159) has the molecular formula C34H49N3O5 and a molecular weight of 579.78 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18043159 |
| Molecular Formula | C34H49N3O5 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.37 |
| IUPAC Name | tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)Nc2ccc(OC)cc2)N(CCCCCCC)C(=O)C(NC(=O)OC(C)(C)C)C(C)C)c1 |
| InChI | InChI=1S/C34H49N3O5/c1-9-11-12-13-14-22-37(32(39)29(24(3)4)36-33(40)42-34(5,6)7)30(26-17-15-16-25(10-2)23-26)31(38)35-27-18-20-28(41-8)21-19-27/h10,15-21,23-24,29-30H,2,9,11-14,22H2,1,3-8H3,(H,35,38)(H,36,40) |
| InChIKey | DGTUOWOQXYVHNH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|