C33H49N3O5 — CID 18043084
tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 18043084) has the molecular formula C33H49N3O5 and a molecular weight of 567.77 g/mol. Its IUPAC name is tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18043084 |
| Molecular Formula | C33H49N3O5 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | tert-butyl N-[1-[heptyl-[2-(4-methoxyanilino)-1-(4-methylphenyl)-2-oxoethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(NC(=O)OC(C)(C)C)C(C)C)C(C(=O)Nc1ccc(OC)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H49N3O5/c1-9-10-11-12-13-22-36(31(38)28(23(2)3)35-32(39)41-33(5,6)7)29(25-16-14-24(4)15-17-25)30(37)34-26-18-20-27(40-8)21-19-26/h14-21,23,28-29H,9-13,22H2,1-8H3,(H,34,37)(H,35,39) |
| InChIKey | MJVGHCBQOWHDSW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|