C32H47N3O5 — CID 18014689
tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014689) has the molecular formula C32H47N3O5 and a molecular weight of 553.74 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014689 |
| Molecular Formula | C32H47N3O5 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(4-methoxyanilino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc(OC)cc1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C32H47N3O5/c1-9-10-11-12-13-18-35(30(37)24(4)33-31(38)40-32(5,6)7)28(25-20-22(2)19-23(3)21-25)29(36)34-26-14-16-27(39-8)17-15-26/h14-17,19-21,24,28H,9-13,18H2,1-8H3,(H,33,38)(H,34,36) |
| InChIKey | JGIQOHQWHPWHHI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|