C36H49N3O4 — CID 18014971
tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014971) has the molecular formula C36H49N3O4 and a molecular weight of 587.81 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014971 |
| Molecular Formula | C36H49N3O4 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.37 |
| IUPAC Name | tert-butyl N-[1-[[1-(3,5-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-octylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C36H49N3O4/c1-8-9-10-11-12-15-20-39(34(41)27(4)37-35(42)43-36(5,6)7)32(30-22-25(2)21-26(3)23-30)33(40)38-31-19-18-28-16-13-14-17-29(28)24-31/h13-14,16-19,21-24,27,32H,8-12,15,20H2,1-7H3,(H,37,42)(H,38,40) |
| InChIKey | YNWIDLRSFMCFRS-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|