C35H47N3O4 — CID 18014731
tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014731) has the molecular formula C35H47N3O4 and a molecular weight of 573.78 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014731 |
| Molecular Formula | C35H47N3O4 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | tert-butyl N-[1-[[1-(2,3-dimethylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-heptylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1cccc(C)c1C |
| InChI | InChI=1S/C35H47N3O4/c1-8-9-10-11-14-22-38(33(40)26(4)36-34(41)42-35(5,6)7)31(30-19-15-16-24(2)25(30)3)32(39)37-29-21-20-27-17-12-13-18-28(27)23-29/h12-13,15-21,23,26,31H,8-11,14,22H2,1-7H3,(H,36,41)(H,37,39) |
| InChIKey | BLMUBCTVOGUZLW-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|