C32H41N3O5 — CID 18014041
tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18014041) has the molecular formula C32H41N3O5 and a molecular weight of 547.70 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18014041 |
| Molecular Formula | C32H41N3O5 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(C)NC(=O)OC(C)(C)C)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C32H41N3O5/c1-6-7-8-11-20-35(30(38)22(2)33-31(39)40-32(3,4)5)28(24-15-18-27(36)19-16-24)29(37)34-26-17-14-23-12-9-10-13-25(23)21-26/h9-10,12-19,21-22,28,36H,6-8,11,20H2,1-5H3,(H,33,39)(H,34,37) |
| InChIKey | UFEDWLOXTKZGBI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|