C35H47N3O5 — CID 18025441
tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18025441) has the molecular formula C35H47N3O5 and a molecular weight of 589.78 g/mol. Its IUPAC name is tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18025441 |
| Molecular Formula | C35H47N3O5 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | tert-butyl N-[1-[hexyl-[1-(4-hydroxyphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCCCCCN(C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)C(C(=O)Nc1ccc2ccccc2c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C35H47N3O5/c1-7-9-10-13-22-38(33(41)30(24(3)8-2)37-34(42)43-35(4,5)6)31(26-17-20-29(39)21-18-26)32(40)36-28-19-16-25-14-11-12-15-27(25)23-28/h11-12,14-21,23-24,30-31,39H,7-10,13,22H2,1-6H3,(H,36,40)(H,37,42) |
| InChIKey | SZVWLCAJHSVAQI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|