C37H47N3O4 — CID 18025456
tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 18025456) has the molecular formula C37H47N3O4 and a molecular weight of 597.80 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 18025456 |
| Molecular Formula | C37H47N3O4 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | tert-butyl N-[1-[[1-(4-ethynylphenyl)-2-(naphthalen-2-ylamino)-2-oxoethyl]-hexylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C#Cc1ccc(C(C(=O)Nc2ccc3ccccc3c2)N(CCCCCC)C(=O)C(NC(=O)OC(C)(C)C)C(C)CC)cc1 |
| InChI | InChI=1S/C37H47N3O4/c1-8-11-12-15-24-40(35(42)32(26(4)9-2)39-36(43)44-37(5,6)7)33(29-20-18-27(10-3)19-21-29)34(41)38-31-23-22-28-16-13-14-17-30(28)25-31/h3,13-14,16-23,25-26,32-33H,8-9,11-12,15,24H2,1-2,4-7H3,(H,38,41)(H,39,43) |
| InChIKey | BMUURRGTTIXELQ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|