C25H40N4O5 — CID 18051282
tert-butyl N-[4-amino-1,4-dioxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]butan-2-yl]carbamate (PubChem CID 18051282) has the molecular formula C25H40N4O5 and a molecular weight of 476.62 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1,4-dioxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1,4-dioxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 18051282 |
| Molecular Formula | C25H40N4O5 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | tert-butyl N-[4-amino-1,4-dioxo-1-[[2-oxo-2-(pentylamino)-1-phenylethyl]-propylamino]butan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(CCC)C(=O)C(CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H40N4O5/c1-6-8-12-15-27-22(31)21(18-13-10-9-11-14-18)29(16-7-2)23(32)19(17-20(26)30)28-24(33)34-25(3,4)5/h9-11,13-14,19,21H,6-8,12,15-17H2,1-5H3,(H2,26,30)(H,27,31)(H,28,33) |
| InChIKey | IMAIZBPGBLKLGF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|